AB60164
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $5.00 | $4.00 | - + | |
10g | 97% (contains ≤10%DCM) | in stock | $10.00 | $7.00 | - + | |
25g | 95% | in stock | $17.00 | $12.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60164 |
Chemical Name: | 2,4-Dichloro-5-nitropyrimidine, tech grade |
CAS Number: | 49845-33-2 |
Molecular Formula: | C4HCl2N3O2 |
Molecular Weight: | 193.9756 |
MDL Number: | MFCD00127867 |
SMILES: | Clc1ncc(c(n1)Cl)[N+](=O)[O-] |
Complexity: | 162 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 2 |
2,4-Dichloro-5-nitropyrimidine is a versatile compound widely used in chemical synthesis for its unique properties. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its presence in the chemical industry is instrumental in the creation of complex molecules through diverse chemical reactions. Specifically, 2,4-Dichloro-5-nitropyrimidine finds application as a valuable intermediate in the synthesis of compounds with biological activities, making it an essential tool for medicinal chemistry and drug discovery. Additionally, its reactivity and stability make it a preferred choice for the development of innovative materials in the field of organic chemistry. Its ability to undergo selective transformations under controlled conditions makes it an indispensable component in the toolkit of synthetic chemists for the creation of novel molecules with diverse functionalities.
Nature chemical biology 20061101