logo
Home  > Chemistry  > Organic Building Blocks  > Alcohols  > Chelidamic acid

AG27464

499-51-4 | Chelidamic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $26.00 $18.00 -   +
5g 98% in stock $34.00 $24.00 -   +
25g 98% in stock $98.00 $69.00 -   +
100g 98% in stock $299.00 $209.00 -   +
500g 98% in stock $1,319.00 $923.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AG27464
Chemical Name: Chelidamic acid
CAS Number: 499-51-4
Molecular Formula: C7H5NO5
Molecular Weight: 183.1183
MDL Number: MFCD31536703
SMILES: Oc1cc(nc(c1)C(=O)O)C(=O)O
NSC Number: 3983

 

Computed Properties
Complexity: 320  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 13  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 2  
XLogP3: -0.4  

 

 

Upstream Synthesis Route
  • 4-Hydroxypyridine-2,6-dicarboxylic acid (HPDCA) plays a crucial role in chemical synthesis as a versatile building block. This compound is widely used in the pharmaceutical and agrochemical industries as a key intermediate in the synthesis of various active compounds. In the realm of drug discovery, HPDCA serves as a precursor for the synthesis of potential drug candidates, contributing to the development of novel medications. Its unique structure and reactivity make it an indispensable tool in the creation of complex molecules with specific biological activities. Additionally, HPDCA can be utilized in the preparation of ligands for coordination chemistry and metal-organic frameworks, showcasing its versatility in a wide range of synthetic applications.
Literature
FEATURED PRODUCTS