AI66270
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $28.00 | $19.00 | - + | |
1g | 98% | in stock | $38.00 | $26.00 | - + | |
5g | 98% | in stock | $153.00 | $107.00 | - + | |
10g | 98% | in stock | $272.00 | $190.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI66270 |
Chemical Name: | 9,10-Secoergosta-5,7,10(19),22-tetraen-3-ol, (3b,5Z,7E,22E)- |
CAS Number: | 50-14-6 |
Molecular Formula: | C28H44O |
Molecular Weight: | 396.6484 |
MDL Number: | MFCD00166988 |
SMILES: | O[C@H]1CCC(=C)/C(=C/C=C/2CCC[C@]3(C2CC[C@@H]3[C@@H](/C=C/[C@@H](C(C)C)C)C)C)/C1 |
Vitamin D2, also known as ergocalciferol, is a vital compound frequently utilized in chemical synthesis processes. This versatile substance plays a crucial role in various reactions due to its unique chemical properties. In the realm of organic chemistry, Vitamin D2 is commonly employed as a precursor in the synthesis of a wide array of important compounds. Its structural composition serves as a valuable starting material for the production of numerous complex molecules, demonstrating its significance in the field of chemical synthesis.Additionally, Vitamin D2 serves as a catalyst or reagent in specific reactions, aiding in the formation of key intermediates or final products. Its ability to participate in various chemical transformations makes it a valuable tool in synthetic chemistry. Furthermore, Vitamin D2 can act as a source of specific functional groups, facilitating the modification of molecular structures during synthesis.Moreover, Vitamin D2's involvement in chemical synthesis extends beyond traditional organic chemistry applications. In fields such as pharmaceuticals, materials science, and biochemistry, Vitamin D2 is integral to the development of new compounds with diverse functionalities. Its compatibility with different reaction conditions and substrates makes it a versatile component in the creation of advanced materials and compounds for a myriad of industrial and research purposes.Overall, the prominent role of Vitamin D2 in chemical synthesis underscores its importance as a fundamental building block for the generation of novel molecules and materials across various scientific disciplines.