AG20862
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 95% | in stock | $158.00 | $110.00 | - + | |
10mg | 95% | in stock | $236.00 | $165.00 | - + | |
25mg | 95 | in stock | $562.00 | $393.00 | - + | |
50mg | 95% | in stock | $708.00 | $495.00 | - + | |
100mg | 95% | in stock | $1,022.00 | $715.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG20862 |
Chemical Name: | Benzeneacetic acid, α,α-diphenyl-, coMpd. with (α1R)-α1-[[[6-[2-[(2,6-dichlorophenyl)Methoxy]ethoxy]hexyl]aMino]Methyl]-4-hydroxy-1,3-benzenediMethanol (1 |
CAS Number: | 503070-58-4 |
Molecular Formula: | C44H47Cl2NO6 |
Molecular Weight: | 756.7531 |
MDL Number: | MFCD21362970 |
SMILES: | OCc1cc(ccc1OC(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O |