AG23235
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $49.00 | $34.00 | - + | |
5g | 98% | in stock | $153.00 | $107.00 | - + | |
25g | 98% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG23235 |
Chemical Name: | 3-(4-Benzyloxyphenyl)propionic acid |
CAS Number: | 50463-48-4 |
Molecular Formula: | C16H16O3 |
Molecular Weight: | 256.2964 |
MDL Number: | MFCD01570264 |
SMILES: | OC(=O)CCc1ccc(cc1)OCc1ccccc1 |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 3 |
Journal of medicinal chemistry 20160526
Journal of medicinal chemistry 20120510
Journal of medicinal chemistry 20110310