AD20379
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $10.00 | $7.00 | - + | |
5mg | 98% | in stock | $22.00 | $16.00 | - + | |
10mg | 98% | in stock | $33.00 | $23.00 | - + | |
50mg | 98% | in stock | $93.00 | $65.00 | - + | |
100mg | 98% | in stock | $158.00 | $111.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD20379 |
Chemical Name: | IRAK-1-4 Inhibitor I |
CAS Number: | 509093-47-4 |
Molecular Formula: | C20H21N5O4 |
Molecular Weight: | 395.4118 |
MDL Number: | MFCD09752602 |
SMILES: | O=C(c1cccc(c1)[N+](=O)[O-])Nc1nc2c(n1CCN1CCOCC1)cccc2 |
Complexity: | 580 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 2 |
Bioorganic & medicinal chemistry letters 20130801
The Biochemical journal 20130415
Nature biotechnology 20111101
Bioorganic & medicinal chemistry letters 20060601
The Journal of biological chemistry 20020419