AB70014
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $6.00 | $4.00 | - + | |
100mg | 98% | in stock | $20.00 | $14.00 | - + | |
1g | 98%(HPLC) | in stock | $24.00 | $17.00 | - + | |
5g | 98% | in stock | $42.00 | $30.00 | - + | |
25g | 98% | in stock | $139.00 | $97.00 | - + | |
100g | 98% | in stock | $449.00 | $315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70014 |
Chemical Name: | 7-(Diethylamino)-2-oxo-2h-chromene-3-carboxylic acid |
CAS Number: | 50995-74-9 |
Molecular Formula: | C14H15NO4 |
Molecular Weight: | 261.2732 |
MDL Number: | MFCD00068721 |
SMILES: | CCN(c1ccc2c(c1)oc(=O)c(c2)C(=O)O)CC |
Complexity: | 400 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.1 |
Bioorganic & medicinal chemistry 20131115
Journal of biomedical optics 20120201
Bioorganic & medicinal chemistry letters 20120115
European journal of medicinal chemistry 20111001
Chembiochem : a European journal of chemical biology 20110321
Biochemistry 20100209
Journal of the American Chemical Society 20091209
Biochemical and biophysical research communications 20080606
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20080401
FEBS letters 20061211
Molecular diversity 20040101
Biochemistry 20020611
The Journal of organic chemistry 20020222
Biophysical journal 20010901
The Journal of biological chemistry 20010706
Chirality 20010515
The Journal of biological chemistry 20010119