AG24348
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $10.00 | $7.00 | - + | |
5g | 95% | in stock | $12.00 | $8.00 | - + | |
10g | 95% | in stock | $20.00 | $14.00 | - + | |
25g | 95% | in stock | $43.00 | $30.00 | - + | |
50g | 95% | in stock | $81.00 | $57.00 | - + | |
100g | 95% | in stock | $155.00 | $108.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG24348 |
Chemical Name: | Boc-Ser(Me)-OH |
CAS Number: | 51293-47-1 |
Molecular Formula: | C9H17NO5 |
Molecular Weight: | 219.23497999999995 |
MDL Number: | MFCD00153314 |
SMILES: | COC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 233 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 0.4 |
Journal of the American Chemical Society 20111221