AB49761
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $19.00 | $13.00 | - + | |
25g | 95% | in stock | $42.00 | $30.00 | - + | |
100g | 95% | in stock | $94.00 | $66.00 | - + | |
500g | 95% | in stock | $462.00 | $323.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49761 |
Chemical Name: | 4-(2,3-Epoxypropoxy)carbazole |
CAS Number: | 51997-51-4 |
Molecular Formula: | C15H13NO2 |
Molecular Weight: | 239.2692 |
MDL Number: | MFCD03411884 |
SMILES: | c1cc(OCC2CO2)c2c(c1)[nH]c1c2cccc1 |
Complexity: | 309 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 3.5 |
European journal of medicinal chemistry 20101101