AX38623
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $105.00 | $74.00 | - + | |
10mg | 98% | in stock | $186.00 | $131.00 | - + | |
25mg | 98% | in stock | $415.00 | $291.00 | - + | |
100mg | 98% | in stock | $1,245.00 | $871.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX38623 |
Chemical Name: | PipecuroniumBromide |
CAS Number: | 52212-02-9 |
Molecular Formula: | C9H23BrN4O7S2 |
Molecular Weight: | 443.3355 |
MDL Number: | MFCD00867696 |
SMILES: | OS(=O)(=O)CCN1CCN(CC1)CCS(=O)(=O)O.NC(=O)N.Br |
Pipecuronium bromide is a vital compound utilized in chemical synthesis as a potent neuromuscular blocking agent. This highly specialized chemical plays a crucial role in the development of pharmaceuticals and research within the medical field. Its unique properties enable precise control over muscle relaxation, making it a valuable tool in various laboratory settings. Additionally, Pipecuronium bromide's effectiveness in blocking neuromuscular transmission highlights its significance in both basic research and advanced drug discovery processes. Its application in chemical synthesis not only showcases its versatility but also underscores its critical role in advancing scientific knowledge and innovation.