AG20723
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $25.00 | $17.00 | - + | |
5g | 98% | in stock | $81.00 | $57.00 | - + | |
10g | 98% | in stock | $129.00 | $90.00 | - + | |
25g | 98% | in stock | $257.00 | $180.00 | - + | |
100g | 98% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG20723 |
Chemical Name: | Ethyl 4-oxo-1,4-dihydro-3-quinolinecarboxylate |
CAS Number: | 52980-28-6 |
Molecular Formula: | C12H11NO3 |
Molecular Weight: | 217.2206 |
MDL Number: | MFCD01314279 |
SMILES: | CCOC(=O)c1cnc2c(c1O)cccc2 |
NSC Number: | 4345 |
Complexity: | 335 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2 |
Journal of medicinal chemistry 20060420