AB47009
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $9.00 | $6.00 | - + | |
1g | 98% | in stock | $13.00 | $9.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
10g | 98% | in stock | $26.00 | $18.00 | - + | |
25g | 98% | in stock | $40.00 | $28.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47009 |
Chemical Name: | 3,5-Dimethoxy-4-hydroxycinnamic acid |
CAS Number: | 530-59-6 |
Molecular Formula: | C11H12O5 |
Molecular Weight: | 224.21 |
MDL Number: | MFCD00004401 |
SMILES: | COc1cc(C=CC(=O)O)cc(c1O)OC |
NSC Number: | 59261 |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.5 |
4-Hydroxy-3,5-dimethoxycinnamic acid, also known as HDMCA, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in organic chemistry reactions, particularly in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, 4-Hydroxy-3,5-dimethoxycinnamic acid acts as a precursor for the preparation of various biologically active molecules. Its hydroxyl and methoxy functional groups provide ample opportunities for derivatization, allowing chemists to modify its structure to achieve desired properties and functions. Additionally, the presence of the cinnamic acid moiety in HDMCA enables it to participate in important reactions such as esterification, amidation, and oxidation.One of the notable applications of 4-Hydroxy-3,5-dimethoxycinnamic acid in chemical synthesis is its role in the production of novel pharmaceutical compounds. By incorporating HDMCA into drug molecules, researchers can enhance the bioavailability, stability, and efficacy of pharmaceutical products. Furthermore, the unique structural features of HDMCA make it a valuable intermediate in the synthesis of natural products and analogs with potential therapeutic applications.Overall, 4-Hydroxy-3,5-dimethoxycinnamic acid plays a crucial role in modern chemical synthesis by serving as a versatile intermediate for the preparation of a diverse range of functional molecules, making it an invaluable tool for medicinal and material chemistry research.