AB49786
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $20.00 | $14.00 | - + | |
5g | 98% | in stock | $92.00 | $65.00 | - + | |
10g | 98% | in stock | $154.00 | $108.00 | - + | |
25g | 98% | in stock | $319.00 | $224.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49786 |
Chemical Name: | (1R,2R)-N1,N1,N2,N2-Tetramethylcyclohexane-1,2-diamine |
CAS Number: | 53152-69-5 |
Molecular Formula: | C10H22N2 |
Molecular Weight: | 170.2951 |
MDL Number: | MFCD03411208 |
SMILES: | CN([C@@H]1CCCC[C@H]1N(C)C)C |
Complexity: | 116 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.6 |
Inorganic chemistry 20071001
The Journal of organic chemistry 20040709