BL18988
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 2 weeks | $115.00 | $80.00 | - + | |
250mg | 95% | 2 weeks | $158.00 | $110.00 | - + | |
1g | 95% | 2 weeks | $300.00 | $210.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BL18988 |
Chemical Name: | 7-Methyl-5′-guanylic acid, inner salt, monoanhydride with 1H-imidazol-1-ylphosphonic acid |
CAS Number: | 531553-69-2 |
Molecular Formula: | C14H19N7O10P2 |
Molecular Weight: | 507.2891 |
SMILES: | O[C@@H]1[C@@H](COP(=O)(OP(=O)(n2cncc2)O)[O-])O[C@H]([C@@H]1O)n1c[n+](c2c1[nH]c(N)nc2=O)C |