AG17277
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $8.00 | $6.00 | - + | |
1g | 98% | in stock | $16.00 | $12.00 | - + | |
5g | 98% | in stock | $46.00 | $33.00 | - + | |
10g | 98% | in stock | $92.00 | $65.00 | - + | |
25g | 98% | in stock | $214.00 | $150.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG17277 |
Chemical Name: | Cis-4-(Boc-amino)cyclohexanecarboxylic acid |
CAS Number: | 53292-90-3 |
Molecular Formula: | C12H21NO4 |
Molecular Weight: | 243.2994 |
MDL Number: | MFCD01862294 |
SMILES: | O=C(OC(C)(C)C)N[C@@H]1CC[C@@H](CC1)C(=O)O |
Complexity: | 287 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.7 |
cis-4-[[1,1-dimethylethoxy)carbonyl]amino]cyclohexanecarboxylic acid, commonly referred to as $name$, is a valuable compound with diverse applications in chemical synthesis. This compound serves as a versatile building block in organic chemistry, particularly in the synthesis of complex molecules and pharmaceuticals. Due to its unique chemical structure, $name$ can participate in various synthetic routes to introduce specific functional groups or stereochemistry into target molecules. Its use in peptide and drug synthesis is particularly noteworthy, as it can act as a protective group for amino acids or as a key intermediate in the construction of biologically active compounds. Furthermore, $name$ can also be employed in the preparation of chiral ligands, catalysts, and other specialized chemicals, making it an essential tool for synthetic chemists seeking to design and create novel molecules with precision and efficiency.