AB71219
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $12.00 | - + | |
1g | 97% | in stock | $25.00 | $18.00 | - + | |
5g | 97% | in stock | $52.00 | $36.00 | - + | |
25g | 97% | in stock | $153.00 | $107.00 | - + | |
100g | 97% | in stock | $510.00 | $357.00 | - + | |
500g | 97% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71219 |
Chemical Name: | 4,4'-Dimethoxy diphenyldisulfide |
CAS Number: | 5335-87-5 |
Molecular Formula: | C14H14O2S2 |
Molecular Weight: | 278.38975999999997 |
MDL Number: | MFCD00041358 |
SMILES: | COc1ccc(cc1)SSc1ccc(cc1)OC |
NSC Number: | 995 |
Complexity: | 198 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 4 |
Chemistry (Weinheim an der Bergstrasse, Germany) 20070101
Journal of medicinal chemistry 19960913