AB56486
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $18.00 | $13.00 | - + | |
1g | 97% | in stock | $41.00 | $29.00 | - + | |
2.5g | 97% | in stock | $102.00 | $72.00 | - + | |
5g | 97% | in stock | $162.00 | $114.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB56486 |
Chemical Name: | 1-(3-Bromophenyl)pyrrole-2,5-dione |
CAS Number: | 53534-14-8 |
Molecular Formula: | C10H6BrNO2 |
Molecular Weight: | 252.06414000000004 |
MDL Number: | MFCD00175233 |
SMILES: | Brc1cccc(c1)N1C(=O)C=CC1=O |
Complexity: | 283 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.8 |
Journal of medicinal chemistry 20091210