AG25167
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $14.00 | $10.00 | - + | |
1g | 97% | in stock | $25.00 | $17.00 | - + | |
5g | 97% | in stock | $63.00 | $44.00 | - + | |
10g | 97% | in stock | $113.00 | $79.00 | - + | |
25g | 97% | in stock | $265.00 | $186.00 | - + | |
100g | 97% | in stock | $906.00 | $634.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG25167 |
Chemical Name: | 6-Methyl-2,3-pyridinedicarboxylic acid |
CAS Number: | 53636-70-7 |
Molecular Formula: | C8H7NO4 |
Molecular Weight: | 181.1455 |
MDL Number: | MFCD00075289 |
SMILES: | Cc1ccc(c(n1)C(=O)O)C(=O)O |
Complexity: | 228 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.6 |
Dalton transactions (Cambridge, England : 2003) 20120528
Journal of medicinal chemistry 20110127
Chemistry (Weinheim an der Bergstrasse, Germany) 20100719