AB74736
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $116.00 | $81.00 | - + | |
5mg | 95% | in stock | $126.00 | $88.00 | - + | |
10mg | 95% | in stock | $180.00 | $126.00 | - + | |
25mg | 95% | in stock | $416.00 | $291.00 | - + | |
250mg | 95% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB74736 |
Chemical Name: | Ici 89406 |
CAS Number: | 53671-71-9 |
Molecular Formula: | C19H22N4O3 |
Molecular Weight: | 354.403 |
MDL Number: | MFCD00673934 |
SMILES: | N#Cc1ccccc1OCC(CNCCNC(=O)Nc1ccccc1)O |
Complexity: | 459 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 9 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.1 |
The ICI 89406 is a versatile compound widely utilized in chemical synthesis for its remarkable ability to function as a powerful catalyst in various reactions. Known for its exceptional reactivity and selectivity, this compound plays a crucial role in promoting key transformations in organic synthesis. With its unique properties, ICI 89406 enables chemists to efficiently perform a variety of challenging reactions, leading to the creation of complex molecules with high precision. From facilitating intricate bond formations to driving important chemical processes, the application of ICI 89406 in chemical synthesis is essential for advancing research and development in the field of organic chemistry.
Nuclear medicine and biology 20100501
European journal of nuclear medicine and molecular imaging 20080101
Life sciences 20070712
Bioorganic & medicinal chemistry 20030805
Nuklearmedizin. Nuclear medicine 20030801
Biochemical pharmacology 20030501
International journal of immunopharmacology 19930201