AB43199
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $4.00 | - + | |
10g | 98% | in stock | $8.00 | $6.00 | - + | |
25g | 98% | in stock | $10.00 | $7.00 | - + | |
100g | 98% | in stock | $32.00 | $22.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43199 |
Chemical Name: | ((1Z,4E)-3-Methylenepenta-1,4-diene-1,5-diyl)dibenzene |
CAS Number: | 538-58-9 |
Molecular Formula: | C17H14O |
Molecular Weight: | 234.2925 |
MDL Number: | MFCD00004790 |
SMILES: | O=C(/C=C/c1ccccc1)/C=C/c1ccccc1 |
NSC Number: | 623642 |
Complexity: | 272 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 2 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.1 |
Free radical research 20120301
Biochemical pharmacology 20111215
Bioorganic & medicinal chemistry letters 20110515
Dalton transactions (Cambridge, England : 2003) 20110414
Journal of medicinal chemistry 20110414
Cancer research 20110115
Bioorganic & medicinal chemistry letters 20101101
Organic & biomolecular chemistry 20081021
European journal of medicinal chemistry 20080801
European journal of medicinal chemistry 20070101
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501
Bioorganic & medicinal chemistry letters 20030106