AG17733
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $25.00 | $17.00 | - + | |
5g | 97% | in stock | $47.00 | $33.00 | - + | |
10g | 97% | in stock | $73.00 | $51.00 | - + | |
25g | 97% | in stock | $145.00 | $102.00 | - + | |
100g | 97% | in stock | $409.00 | $286.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG17733 |
Chemical Name: | 1-(3-nitrophenyl)piperazine |
CAS Number: | 54054-85-2 |
Molecular Formula: | C10H13N3O2 |
Molecular Weight: | 207.2291 |
MDL Number: | MFCD03444407 |
SMILES: | [O-][N+](=O)c1cccc(c1)N1CCNCC1 |
Complexity: | 223 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.9 |
Journal of medicinal chemistry 20011108