AB73540
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $70.00 | $49.00 | - + | |
25g | 95% | in stock | $106.00 | $75.00 | - + | |
100g | 95% | in stock | $325.00 | $228.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73540 |
Chemical Name: | Ethyl 2,3-dibromo-3-phenylpropionate |
CAS Number: | 5464-70-0 |
Molecular Formula: | C11H12Br2O2 |
Molecular Weight: | 336.0198 |
MDL Number: | MFCD10000889 |
SMILES: | CCOC(=O)C(C(c1ccccc1)Br)Br |
Complexity: | 203 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 5 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 3.6 |
Journal of chemical ecology 20011101