AB71037
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $10.00 | $7.00 | - + | |
5g | 95% | in stock | $39.00 | $27.00 | - + | |
10g | 95% | in stock | $72.00 | $51.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71037 |
Chemical Name: | Benzyl 4-methylbenzoate |
CAS Number: | 5467-99-2 |
Molecular Formula: | C15H14O2 |
Molecular Weight: | 226.2705 |
MDL Number: | MFCD04347391 |
SMILES: | Cc1ccc(cc1)C(=O)OCc1ccccc1 |
NSC Number: | 25467 |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.3 |
Benzyl 4-methylbenzoate, also known as methyl 4-[(phenylmethyl)oxy]benzoate, is a versatile compound widely utilized in chemical synthesis. This compound serves as a key building block in the creation of various organic molecules and materials due to its unique chemical properties.In chemical synthesis, Benzyl 4-methylbenzoate is commonly used as a protecting group for alcohols and phenols during multi-step organic reactions. By attaching this compound to the hydroxyl group of an alcohol or phenol, it effectively shields the reactive site from unwanted reactions while allowing other parts of the molecule to undergo transformation. This protection strategy is crucial in controlling the selectivity and efficiency of complex chemical transformations.Additionally, Benzyl 4-methylbenzoate can serve as a precursor for the synthesis of other functionalized molecules through cleavage of the benzyl ester linkage. This process enables the introduction of new functional groups or modifications to the original molecule, expanding the range of potential applications in organic chemistry.Overall, Benzyl 4-methylbenzoate plays a fundamental role in chemical synthesis by offering a versatile platform for the construction of intricate organic structures with controlled reactivity and functionality. Its applicability extends across various fields of chemistry, making it an indispensable tool for chemists striving to create novel compounds and materials.