AB75801
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100g | 97% | in stock | $16.00 | $11.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB75801 |
Chemical Name: | Methyl 3-methyl-2-nitrobenzoate |
CAS Number: | 5471-82-9 |
Molecular Formula: | C9H9NO4 |
Molecular Weight: | 195.1721 |
MDL Number: | MFCD01003947 |
SMILES: | COC(=O)c1cccc(c1[N+](=O)[O-])C |
NSC Number: | 28461 |
Complexity: | 236 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
Methyl 3-methyl-2-nitrobenzoate is a versatile compound widely used in chemical synthesis as a key intermediate for the production of various organic compounds. Its unique chemical structure allows it to participate in a wide range of reactions, making it an essential building block in many organic synthesis pathways.One of the primary applications of Methyl 3-methyl-2-nitrobenzoate is in the preparation of pharmaceuticals and agrochemicals. Its functional groups can be selectively modified to introduce specific characteristics or improve the activity of the final product. Additionally, it can serve as a precursor for the synthesis of more complex molecules through various chemical transformations.Furthermore, Methyl 3-methyl-2-nitrobenzoate is utilized in the development of new materials, such as polymers and dyes. Its structural versatility allows for the creation of tailored materials with specific properties, including optical, electrical, or mechanical characteristics. This compound plays a critical role in expanding the scope of materials science research and innovation.In summary, Methyl 3-methyl-2-nitrobenzoate is a valuable compound in chemical synthesis, enabling the creation of diverse organic molecules with applications in pharmaceuticals, agrochemicals, and materials science. Its versatility and reactivity make it an indispensable tool for researchers and chemists seeking to develop novel compounds and materials for various industrial and academic purposes.