AZ23238
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $38.00 | $27.00 | - + | |
1g | 96% | in stock | $74.00 | $52.00 | - + | |
5g | 95% | in stock | $120.00 | $84.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AZ23238 |
Chemical Name: | 2-(2,6-Dioxopiperidin-3-yl)-5-nitroisoindole-1,3-dione |
CAS Number: | 55003-81-1 |
Molecular Formula: | C13H9N3O6 |
Molecular Weight: | 303.2271 |
MDL Number: | MFCD30188076 |
SMILES: | O=C1CCC(C(=O)N1)N1C(=O)c2c(C1=O)cc(cc2)[N+](=O)[O-] |
1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-nitro is a versatile compound widely utilized in chemical synthesis. Its unique structure and properties make it valuable for various applications within the realm of organic chemistry. In particular, this compound serves as a key building block in the synthesis of complex molecules and pharmaceutical intermediates. Its strategic placement of functional groups allows for efficient manipulation and derivatization, enabling chemists to access diverse chemical space for the creation of new compounds. With its potential to participate in a variety of reactions, 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-nitro is a valuable tool for the synthesis of novel compounds with potential medicinal, agricultural, or material science applications.