AB50973
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | ≥97% | in stock | $15.00 | $10.00 | - + | |
1g | ≥97% | in stock | $20.00 | $14.00 | - + | |
5g | 95% | in stock | $82.00 | $57.00 | - + | |
25g | 95% | in stock | $202.00 | $141.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50973 |
Chemical Name: | D-Mannosamine HCl |
CAS Number: | 5505-63-5 |
Molecular Formula: | C6H14ClNO5 |
Molecular Weight: | 215.6321 |
MDL Number: | MFCD00064557 |
SMILES: | OC[C@H]([C@H]([C@@H]([C@@H](C=O)N)O)O)O.Cl |
Complexity: | 142 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 5 |
2-Amino-2-deoxy-D-mannose hydrochloride is a versatile compound widely used in chemical synthesis for the efficient incorporation of aminosugars into complex molecules. This compound serves as a key building block for the synthesis of various bioactive molecules, pharmaceuticals, and natural products. Its unique properties make it a valuable tool in the development of new drugs, agrochemicals, and materials. In the realm of chemical synthesis, 2-Amino-2-deoxy-D-mannose hydrochloride plays a crucial role in creating diverse molecular structures with enhanced biological activities and functional properties. Its applications extend across multiple domains, highlighting its significance in advancing innovation and discovery in the field of organic chemistry.