AB61480
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $13.00 | $9.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
10g | 98% | in stock | $19.00 | $14.00 | - + | |
25g | 98% | in stock | $46.00 | $33.00 | - + | |
100g | 98% | in stock | $183.00 | $128.00 | - + | |
500g | 98% | in stock | $875.00 | $613.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61480 |
Chemical Name: | 1-Bromo-2-methyl-3-nitrobenzene |
CAS Number: | 55289-35-5 |
Molecular Formula: | C7H6BrNO2 |
Molecular Weight: | 216.0320 |
MDL Number: | MFCD00018074 |
SMILES: | [O-][N+](=O)c1cccc(c1C)Br |
Complexity: | 157 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 3.2 |
1-Bromo-2-methyl-3-nitrobenzene is a versatile compound used in chemical synthesis for various applications. This compound serves as an important building block in the preparation of pharmaceuticals, agrochemicals, and other specialty chemicals. It is commonly employed as a key intermediate in the synthesis of various organic molecules due to its unique structure and reactivity.In chemical synthesis, 1-Bromo-2-methyl-3-nitrobenzene can undergo various reactions such as nucleophilic aromatic substitution, reduction, and coupling reactions to introduce different functional groups into the molecule. These reactions allow chemists to modify the chemical structure of the compound to generate a wide range of derivatives with diverse properties and applications.Additionally, 1-Bromo-2-methyl-3-nitrobenzene can be utilized in the preparation of complex organic compounds, heterocycles, and chiral building blocks. Its ability to participate in multiple chemical transformations makes it a valuable tool in the toolbox of synthetic chemists for the efficient and selective construction of organic molecules with specific structural features and functionalities.