AG32821
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $6.00 | $4.00 | - + | |
250mg | 95% | in stock | $8.00 | $6.00 | - + | |
1g | 95% | in stock | $17.00 | $12.00 | - + | |
25g | 95% | in stock | $337.00 | $236.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG32821 |
Chemical Name: | N-Cyano-N-phenyl-p-toluenesulfonamide |
CAS Number: | 55305-43-6 |
Molecular Formula: | C14H12N2O2S |
Molecular Weight: | 272.3223 |
MDL Number: | MFCD00159358 |
SMILES: | N#CN(S(=O)(=O)c1ccc(cc1)C)c1ccccc1 |
Complexity: | 432 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 3 |
Benzenesulfonamide, N-cyano-4-methyl-N-phenyl- is a versatile chemical compound commonly used in chemical synthesis. Its unique properties make it a valuable reagent in various reactions, particularly in organic synthesis. This compound serves as a key building block in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. By acting as a nucleophilic reagent, it participates in reactions such as nucleophilic addition, substitution, and condensation, enabling the formation of complex organic structures. The presence of the cyano group and substituted phenyl group confers specific reactivity that is essential for the formation of intricate molecular architectures. Additionally, the sulfonamide functionality enhances the compound's stability and solubility in various reaction conditions, making it a favorable choice in synthetic protocols. Chemists rely on Benzenesulfonamide, N-cyano-4-methyl-N-phenyl- for its versatility and reliability in chemical transformations, highlighting its significance in modern organic synthesis.