AB59645
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $17.00 | $12.00 | - + | |
5g | 96% | in stock | $58.00 | $40.00 | - + | |
25g | 96% | in stock | $156.00 | $110.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB59645 |
Chemical Name: | 2,2-Diphenylpropionic acid |
CAS Number: | 5558-66-7 |
Molecular Formula: | C15H14O2 |
Molecular Weight: | 226.2705 |
MDL Number: | MFCD00004189 |
SMILES: | OC(=O)C(c1ccccc1)(c1ccccc1)C |
NSC Number: | 82164 |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.7 |
Bioorganic & medicinal chemistry letters 20101101
Journal of medicinal chemistry 20020214