AB72084
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $64.00 | $45.00 | - + | |
250mg | 98% | in stock | $100.00 | $70.00 | - + | |
1g | 95% | in stock | $372.00 | $260.00 | - + | |
5g | 95% | in stock | $1,280.00 | $896.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB72084 |
Chemical Name: | Cis-11-eicosenoic acid |
CAS Number: | 5561-99-9 |
Molecular Formula: | C20H38O2 |
Molecular Weight: | 310.5145 |
MDL Number: | MFCD00010506 |
SMILES: | CCCCCCCC/C=C\CCCCCCCCCC(=O)O |
(Z)-Icos-11-enoic acid, also known as erucic acid, is a valuable compound in chemical synthesis due to its versatile applications. This unsaturated fatty acid plays a crucial role in the production of various industrial products, including surfactants, lubricants, and polymers. In chemical synthesis, (Z)-Icos-11-enoic acid serves as a key building block for the creation of complex organic molecules. Its unique chemical structure allows for the formation of bonds with other molecules, enabling the synthesis of compounds used in pharmaceuticals, agrochemicals, and flavors. Additionally, (Z)-Icos-11-enoic acid can be utilized in the development of specialty chemicals and bio-based materials, further expanding its potential in diverse fields of chemistry.