AB62845
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $9.00 | $6.00 | - + | |
5g | 97% | in stock | $10.00 | $7.00 | - + | |
10g | 97% | in stock | $14.00 | $10.00 | - + | |
25g | 97% | in stock | $33.00 | $23.00 | - + | |
100g | 97% | in stock | $129.00 | $90.00 | - + | |
500g | 97% | in stock | $641.00 | $449.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB62845 |
Chemical Name: | 2-Nitrophenylboronic acid |
CAS Number: | 5570-19-4 |
Molecular Formula: | C6H6BNO4 |
Molecular Weight: | 166.9271 |
MDL Number: | MFCD00161358 |
SMILES: | [O-][N+](=O)c1ccccc1B(O)O |
Complexity: | 169 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
(2-Nitrophenyl)boronic acid is a valuable chemical compound widely used in organic synthesis. Its application in chemical synthesis is primarily as a versatile building block for the preparation of various functionalized organic molecules. When used in coupling reactions, (2-Nitrophenyl)boronic acid acts as a key reagent in Suzuki-Miyaura cross-coupling reactions. This reaction allows for the formation of carbon-carbon bonds between an aryl halide and an arylboronic acid or ester, leading to the synthesis of biaryl compounds. Additionally, (2-Nitrophenyl)boronic acid can undergo further derivatization to introduce a range of functional groups onto the phenyl ring. This versatility makes it a valuable tool in the preparation of pharmaceuticals, agrochemicals, and materials science.In summary, (2-Nitrophenyl)boronic acid plays a crucial role in modern organic synthesis, enabling chemists to construct complex and diverse organic molecules through efficient coupling reactions and derivatization strategies.
Journal of agricultural and food chemistry 20111109
Chemistry (Weinheim an der Bergstrasse, Germany) 20100510
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20061205
Die Pharmazie 20061101
Die Pharmazie 20060401
Bioorganic & medicinal chemistry letters 20040105