AB46013
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98%(HPLC) | in stock | $25.00 | $18.00 | - + | |
5g | 98% | in stock | $34.00 | $24.00 | - + | |
25g | 98% | in stock | $74.00 | $52.00 | - + | |
100g | 98% | in stock | $216.00 | $151.00 | - + | |
500g | 98% | in stock | $1,008.00 | $706.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46013 |
Chemical Name: | Estradiene dione-3-keta |
CAS Number: | 5571-36-8 |
Molecular Formula: | C20H26O3 |
Molecular Weight: | 314.4186 |
MDL Number: | MFCD08062585 |
SMILES: | O=C1CC[C@@H]2[C@]1(C)CC=C1[C@H]2CCC2=C1CCC1(C2)OCCO1 |
Complexity: | 623 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 1.8 |
Estradiene dione-3-ketone, also known as 1,3,5(10)-estratrien-3,17-dione, plays a crucial role in chemical synthesis as a key intermediate in the production of various pharmaceuticals, hormones, and other organic compounds. This compound serves as a versatile building block for the synthesis of steroidal drugs and hormone derivatives due to its unique structure and reactivity. Estradiene dione-3-ketone is commonly used in the pharmaceutical industry for the development of hormonal therapies, anti-inflammatory medications, and other therapeutic agents. Its chemical properties and functional groups make it a valuable starting material for the creation of diverse chemical compounds with important biological activities. In addition, the strategic incorporation of Estradiene dione-3-ketone into synthetic routes enables chemists to access complex molecular structures efficiently and with high precision.