AB50977
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $7.00 | $5.00 | - + | |
25g | 98% | in stock | $14.00 | $10.00 | - + | |
100g | 98% | in stock | $54.00 | $38.00 | - + | |
500g | 98% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50977 |
Chemical Name: | Tetrabutylammonium dihydrogen phosphate |
CAS Number: | 5574-97-0 |
Molecular Formula: | C16H38NO4P |
Molecular Weight: | 339.4510 |
MDL Number: | MFCD00064526 |
SMILES: | [O-]P(=O)(O)O.CCCC[N+](CCCC)(CCCC)CCCC |
Complexity: | 166 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 12 |
Tetrabutylammonium dihydrogenphosphate is a versatile compound commonly used in chemical synthesis as a phase transfer catalyst. In organic chemistry, it facilitates the transfer of reactants between aqueous and organic phases, aiding in the efficient reaction of otherwise immiscible substances. This compound plays a crucial role in promoting various reactions such as nucleophilic substitution, alkylation, and oxidation, by enabling the interaction of reactants that would not normally mix. Its unique properties make it a valuable tool for researchers and chemists working on complex synthesis processes, offering a means to streamline reactions and enhance overall efficiency. With its ability to drive reactions forward and increase yield, Tetrabutylammonium dihydrogenphosphate is an indispensable component in the toolkit of synthetic chemists seeking to push the boundaries of chemical synthesis.
Bioorganic & medicinal chemistry letters 20090901