AI52497
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $19.00 | $14.00 | - + | |
25g | 95% | in stock | $31.00 | $22.00 | - + | |
100g | 98% | in stock | $105.00 | $73.00 | - + | |
500g | 98% | in stock | $521.00 | $365.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI52497 |
Chemical Name: | 6-Maleimidocaproic acid |
CAS Number: | 55750-53-3 |
Molecular Formula: | C10H13NO4 |
Molecular Weight: | 211.2145 |
MDL Number: | MFCD00043140 |
SMILES: | OC(=O)CCCCCN1C(=O)C=CC1=O |
Complexity: | 291 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.1 |
Bioconjugate chemistry 20090601
International journal of cancer 20080301
Archiv der Pharmazie 20070801
Chemical & pharmaceutical bulletin 20070401
Chembiochem : a European journal of chemical biology 20070305
Bioconjugate chemistry 20070101
Archiv der Pharmazie 20051001
Bioconjugate chemistry 20040101
Bioorganic & medicinal chemistry 20030102
Journal of neurochemistry 20021101
Journal of medicinal chemistry 19960412