AI52561
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97 | in stock | $3.00 | $2.00 | - + | |
5mg | 97 | in stock | $13.00 | $9.00 | - + | |
1g | 99% | in stock | $15.00 | $10.00 | - + | |
5g | 99% | in stock | $18.00 | $12.00 | - + | |
25g | 97 | in stock | $25.00 | $17.00 | - + | |
500g | 97% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI52561 |
Chemical Name: | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
CAS Number: | 56-75-7 |
Molecular Formula: | C11H12Cl2N2O5 |
Molecular Weight: | 323.1294 |
MDL Number: | MFCD27987034 |
SMILES: | OCC(C(c1ccc(cc1)[N+](=O)[O-])O)NC(=O)C(Cl)Cl |
D-(-)-threo-1-(4-Nitrophenyl)-2-dichloroacetamido-1,3-propanediol is a versatile compound widely utilized in chemical synthesis for its unique properties and reactions. This compound serves as a key building block in the creation of various organic molecules due to its functional groups and stereochemistry.In chemical synthesis, D-(-)-threo-1-(4-Nitrophenyl)-2-dichloroacetamido-1,3-propanediol acts as a potent starting material for the construction of complex structures with precise stereochemical control. Its dichloroacetamido group provides a reactive site for nucleophilic substitution reactions, allowing for the introduction of different substituents. The 4-Nitrophenyl group further enhances its reactivity and compatibility with various reaction conditions.Moreover, the specific configuration of D-(-)-threo-1-(4-Nitrophenyl)-2-dichloroacetamido-1,3-propanediol plays a crucial role in determining the stereochemistry of the final product. By strategically incorporating this compound into synthetic pathways, chemists can achieve targeted outcomes with high selectivity and efficiency. Its compatibility with common reagents and catalysts makes it a valuable asset in the synthesis of pharmaceuticals, agrochemicals, and advanced materials.Overall, the application of D-(-)-threo-1-(4-Nitrophenyl)-2-dichloroacetamido-1,3-propanediol in chemical synthesis opens up a myriad of possibilities for creating structurally diverse compounds with tailored properties and functionalities. Its versatility and reliability make it a preferred choice for synthetic chemists seeking to design novel molecules with precision and control.