AB49186
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 97% | in stock | $12.00 | $9.00 | - + | |
5g | 97% | in stock | $49.00 | $35.00 | - + | |
10g | 97% | in stock | $86.00 | $61.00 | - + | |
25g | 97% | in stock | $187.00 | $131.00 | - + | |
100g | 97% | in stock | $744.00 | $521.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49186 |
Chemical Name: | Diethyl (phenylsulfonyl)methanephosphonate |
CAS Number: | 56069-39-7 |
Molecular Formula: | C11H17O5PS |
Molecular Weight: | 292.2884 |
MDL Number: | MFCD03453041 |
SMILES: | CCOP(=O)(CS(=O)(=O)c1ccccc1)OCC |
Complexity: | 371 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 7 |
XLogP3: | 1.2 |
The Journal of organic chemistry 20100702