AI52608
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
50mg | 98% | in stock | $7.00 | $5.00 | - + | |
250mg | 98% | in stock | $18.00 | $13.00 | - + | |
1g | 98% | in stock | $35.00 | $25.00 | - + | |
5g | 95 - 102% (HPLC) | in stock | $104.00 | $73.00 | - + | |
25g | 95 - 102% (HPLC) | in stock | $310.00 | $217.00 | - + | |
100g | 95 - 102% (HPLC) | in stock | $785.00 | $549.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI52608 |
Chemical Name: | Acarbose |
CAS Number: | 56180-94-0 |
Molecular Formula: | C25H43NO18 |
Molecular Weight: | 645.6048 |
MDL Number: | MFCD23136977 |
SMILES: | OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@H](C)[C@H]([C@@H]([C@H]1O)O)N[C@H]1C=C(CO)[C@H]([C@@H]([C@H]1O)O)O)O |
The compound O-4,6-Dideoxy-4-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-D-glucose, also known as $name$, has found significant application in chemical synthesis. This compound serves as a versatile building block in the synthesis of complex carbohydrates and glycoconjugates. Due to its unique structure and functional groups, $name$ can be employed in the creation of intricate molecular architectures with precise stereochemistry, which is crucial in the development of pharmaceuticals, materials, and bioconjugates. In chemical synthesis, $name$ acts as a key intermediate, facilitating the assembly of sophisticated carbohydrate derivatives through controlled glycosylation reactions. Its specific arrangement of sugar moieties and amino groups provides a platform for creating diverse molecular structures with high selectivity and efficiency.