AB49624
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $15.00 | $11.00 | - + | |
5mg | 98% | in stock | $34.00 | $24.00 | - + | |
10mg | 98% | in stock | $48.00 | $34.00 | - + | |
100mg | 98% | in stock | $274.00 | $192.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49624 |
Chemical Name: | Epirubicin hydrochloride |
CAS Number: | 56390-09-1 |
Molecular Formula: | C27H30ClNO11 |
Molecular Weight: | 579.9802 |
MDL Number: | MFCD00274554 |
SMILES: | OCC(=O)[C@@]1(O)C[C@H](O[C@H]2C[C@H](N)[C@H]([C@@H](O2)C)O)c2c(C1)c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2OC.Cl |
In the field of chemical synthesis, 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-α-L-arabino-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(2-hydroxyacetyl)-1-methoxy-, hydrochloride (1:1), (8S,10S), serves as a crucial component for the efficient production of various pharmaceutical intermediates and compounds. Its specific structural arrangement and functional groups enable precise manipulation and modification during synthetic processes, leading to the creation of novel drug candidates and biologically active molecules with potential therapeutic applications.