AB49163
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 2 weeks | $427.00 | $299.00 | - + | |
250mg | 95% | 2 weeks | $674.00 | $472.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49163 |
Chemical Name: | 4-[(1-Ethylpropyl)amino]-2-methyl-3,5-dinitrobenzenemethanol |
CAS Number: | 56750-76-6 |
Molecular Formula: | C13H19N3O5 |
Molecular Weight: | 297.3071 |
MDL Number: | MFCD01657415 |
SMILES: | CCC(Nc1c(cc(c(c1[N+](=O)[O-])C)CO)[N+](=O)[O-])CC |
Complexity: | 364 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.9 |
Journal of agricultural and food chemistry 20010501