AB72438
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100g | 98% | in stock | $7.00 | $5.00 | - + | |
500g | 98% | in stock | $15.00 | $11.00 | - + | |
25kg | 98 - 102% (Assay) | in stock | $612.00 | $428.00 | - + | |
100kg | 98 - 102% (Assay) | in stock | $2,162.00 | $1,513.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB72438 |
Chemical Name: | D-(-)-Fructose |
CAS Number: | 57-48-7 |
Molecular Formula: | C6H12O6 |
Molecular Weight: | 180.1559 |
MDL Number: | MFCD00148910 |
SMILES: | OC[C@H]([C@H]([C@@H](C(=O)CO)O)O)O |
Complexity: | 147 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 5 |
XLogP3: | -3.2 |
D-Fructose, a monosaccharide sugar commonly known as fruit sugar, plays a significant role in chemical synthesis as a versatile building block in various reactions. Thanks to its unique structure and reactivity, D-Fructose is employed in the production of pharmaceuticals, flavoring agents, and other valuable compounds.In organic chemistry, D-Fructose can be utilized as a starting material for the synthesis of complex molecules, such as heterocycles and carbohydrates. Its hydroxyl groups and aldehyde functionality enable the formation of diverse derivatives through selective chemical transformations, including oxidation, reduction, and substitution reactions.Furthermore, D-Fructose finds application in the synthesis of glycosides and glycoconjugates, essential components in biochemistry and medicinal chemistry. By linking D-Fructose to other molecules, researchers can create novel compounds with improved bioavailability, stability, or biological activity.Overall, the versatile nature of D-Fructose makes it a valuable tool in chemical synthesis, offering opportunities for the creation of new compounds with exciting properties and potential applications in various fields.