logo
Home  > Pregn-4-ene-3,20-dione

AI52792

57-83-0 | Pregn-4-ene-3,20-dione

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $10.00 $7.00 -   +
1g 98% in stock $26.00 $18.00 -   +
5g 98% in stock $56.00 $39.00 -   +
25g 98% in stock $158.00 $110.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI52792
Chemical Name: Pregn-4-ene-3,20-dione
CAS Number: 57-83-0
Molecular Formula: C21H30O2
Molecular Weight: 314.4617
MDL Number: MFCD00003658
SMILES: O=C1CC[C@]2(C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(=O)C)C)C

 

Upstream Synthesis Route 
  • The compound Pregn-4-ene-3,20-dione, also known as progesterone, plays a crucial role in chemical synthesis as a key intermediate in the production of various pharmaceuticals and hormones. This versatile molecule is utilized in the synthesis of a wide range of pharmaceutical products, including contraceptives, hormone replacement therapies, and anti-inflammatory medications. Progesterone's unique chemical structure allows for its transformation into various derivatives, enabling its widespread application in the pharmaceutical industry. Its role in chemical synthesis extends to the creation of new drug molecules with enhanced therapeutic effects and improved bioavailability. Additionally, progesterone serves as a valuable starting material for the synthesis of other important steroids, making it an indispensable component in the production of numerous pharmaceutical compounds.
FEATURED PRODUCTS