AB50964
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $18.00 | $12.00 | - + | |
5g | 98% | in stock | $51.00 | $36.00 | - + | |
25g | 98% | in stock | $129.00 | $90.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50964 |
Chemical Name: | Dimethyl 2-aminoisophthalate |
CAS Number: | 57053-02-8 |
Molecular Formula: | C10H11NO4 |
Molecular Weight: | 209.1986 |
MDL Number: | MFCD18431747 |
SMILES: | COC(=O)c1cccc(c1N)C(=O)OC |
Complexity: | 230 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.4 |
Dimethyl 2-aminoisophthalate, also known as DMIA, is a versatile chemical compound widely used in chemical synthesis. This compound serves as a key building block in organic chemistry, specifically in the synthesis of various pharmaceuticals, polymers, and other complex molecules. DMIA is valued for its ability to participate in diverse reactions, leading to the formation of important intermediates and final products. Its unique structure and reactivity make it a valuable tool for chemists seeking to tailor molecular structures with precision and efficiency. In particular, dimethyl 2-aminoisophthalate plays a crucial role in the synthesis of drug molecules, agrochemicals, and advanced materials, highlighting its significance in modern chemical research and development.