logo
Home  > Chemistry  > Organic Building Blocks  > Esters  > Dimethyl 2-aminoisophthalate

AB50964

57053-02-8 | Dimethyl 2-aminoisophthalate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $8.00 $5.00 -   +
1g 95% in stock $18.00 $12.00 -   +
5g 95% in stock $46.00 $32.00 -   +
10g 95% in stock $84.00 $59.00 -   +
25g 95% in stock $120.00 $84.00 -   +
50g 95% in stock $240.00 $168.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB50964
Chemical Name: Dimethyl 2-aminoisophthalate
CAS Number: 57053-02-8
Molecular Formula: C10H11NO4
Molecular Weight: 209.1986
MDL Number: MFCD18431747
SMILES: COC(=O)c1cccc(c1N)C(=O)OC

 

Computed Properties
Complexity: 230  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 4  
XLogP3: 1.4  

 

 

Upstream Synthesis Route
  • Dimethyl 2-aminoisophthalate, also known as DMIA, is a versatile chemical compound widely used in chemical synthesis. This compound serves as a key building block in organic chemistry, specifically in the synthesis of various pharmaceuticals, polymers, and other complex molecules. DMIA is valued for its ability to participate in diverse reactions, leading to the formation of important intermediates and final products. Its unique structure and reactivity make it a valuable tool for chemists seeking to tailor molecular structures with precision and efficiency. In particular, dimethyl 2-aminoisophthalate plays a crucial role in the synthesis of drug molecules, agrochemicals, and advanced materials, highlighting its significance in modern chemical research and development.
FEATURED PRODUCTS