AG69644
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $6.00 | $4.00 | - + | |
1g | 97% | in stock | $11.00 | $8.00 | - + | |
5g | 97% | in stock | $38.00 | $27.00 | - + | |
10g | 97% | in stock | $64.00 | $45.00 | - + | |
25g | 97% | in stock | $135.00 | $95.00 | - + | |
100g | 97% | in stock | $445.00 | $311.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG69644 |
Chemical Name: | 11-Maleimidoundecanoic acid |
CAS Number: | 57079-01-3 |
Molecular Formula: | C15H23NO4 |
Molecular Weight: | 281.3474 |
MDL Number: | MFCD18974034 |
SMILES: | OC(=O)CCCCCCCCCCN1C(=O)C=CC1=O |
Complexity: | 358 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 11 |
XLogP3: | 3.7 |
Journal of medicinal chemistry 19960412