AB76456
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $106.00 | $75.00 | - + | |
1g | 95% | in stock | $299.00 | $209.00 | - + | |
5g | 95% | in stock | $1,132.00 | $793.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB76456 |
Chemical Name: | N-(3-Indolylacetyl)-l-valine |
CAS Number: | 57105-42-7 |
Molecular Formula: | C15H18N2O3 |
Molecular Weight: | 274.3150 |
MDL Number: | MFCD00075402 |
SMILES: | O=C(Cc1c[nH]c2c1cccc2)N[C@H](C(=O)O)C(C)C |
Complexity: | 370 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.1 |
Analytical chemistry 20070215
The Plant cell 20050201