logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Other Aliphatic Heterocycles  > (3Ar,6as)-rel-hexahydro-1h-furo[3,4-c]pyrrole hydrochloride

AG69520

57710-36-8 | (3Ar,6as)-rel-hexahydro-1h-furo[3,4-c]pyrrole hydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $15.00 $10.00 -   +
250mg 95% in stock $21.00 $15.00 -   +
1g 95% in stock $60.00 $42.00 -   +
5g 95% in stock $299.00 $210.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AG69520
Chemical Name: (3Ar,6as)-rel-hexahydro-1h-furo[3,4-c]pyrrole hydrochloride
CAS Number: 57710-36-8
Molecular Formula: C6H12ClNO
Molecular Weight: 149.61858
MDL Number: MFCD20527059
SMILES: N1C[C@@H]2[C@H](C1)COC2.Cl

 

Computed Properties
Complexity: 84.5  
Covalently-Bonded Unit Count: 2  
Defined Atom Stereocenter Count: 2  
Heavy Atom Count: 9  
Hydrogen Bond Acceptor Count: 2  
Hydrogen Bond Donor Count: 2  

 

 

Upstream Synthesis Route
  • (3aR,6aS)-rel-Hexahydro-1H-furo[3,4-c]pyrrole hydrochloride is a versatile compound used in chemical synthesis for the preparation of heterocyclic compounds. This product serves as a key building block in the formation of complex organic molecules, particularly in the synthesis of bioactive compounds and pharmaceuticals. Its unique molecular structure allows for strategic functionalization, making it a valuable tool for designing efficient synthetic routes. Additionally, (3aR,6aS)-rel-Hexahydro-1H-furo[3,4-c]pyrrole hydrochloride exhibits excellent reactivity in various reactions, enabling chemists to access diverse chemical space and create novel molecular architectures. This compound plays a crucial role in the synthesis of compounds with potential applications in drug discovery, materials science, and agrochemicals.
FEATURED PRODUCTS