AB45389
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $13.00 | $9.00 | - + | |
5g | 98% | in stock | $14.00 | $10.00 | - + | |
10g | 98% | in stock | $24.00 | $17.00 | - + | |
25g | 98% | in stock | $50.00 | $35.00 | - + | |
100g | 98% | in stock | $159.00 | $111.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45389 |
Chemical Name: | 6-Bromo-2-naphthoic acid |
CAS Number: | 5773-80-8 |
Molecular Formula: | C11H7BrO2 |
Molecular Weight: | 251.0761 |
MDL Number: | MFCD01075720 |
SMILES: | Brc1ccc2c(c1)ccc(c2)C(=O)O |
Complexity: | 229 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 4 |
Bioorganic chemistry 20110801
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20080601