AJ17093
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $13.00 | $9.00 | - + | |
5g | 97% | in stock | $20.00 | $14.00 | - + | |
10g | 97% | in stock | $36.00 | $25.00 | - + | |
25g | 97% | in stock | $80.00 | $56.00 | - + | |
100g | 97% | in stock | $319.00 | $224.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AJ17093 |
Chemical Name: | Methyl 2,4-dihydroxy-6-pentylbenzoate |
CAS Number: | 58016-28-7 |
Molecular Formula: | C13H18O4 |
Molecular Weight: | 238.2796 |
MDL Number: | MFCD06737776 |
SMILES: | CCCCCc1cc(O)cc(c1C(=O)OC)O |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 4 |
Zeitschrift fur Naturforschung. C, Journal of biosciences 20080101