AG70438
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 97% | in stock | $26.00 | $18.00 | - + | |
100mg | 97% | in stock | $45.00 | $32.00 | - + | |
250mg | 97% | in stock | $70.00 | $49.00 | - + | |
1g | 97% | in stock | $182.00 | $128.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG70438 |
Chemical Name: | Cyclo(-ala-ala) |
CAS Number: | 5845-61-4 |
Molecular Formula: | C6H10N2O2 |
Molecular Weight: | 142.1558 |
MDL Number: | MFCD00190738 |
SMILES: | C[C@@H]1NC(=O)[C@@H](NC1=O)C |
Complexity: | 159 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | -0.5 |
Amino acids 20120701
Journal of computational chemistry 20030715