AG76776
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $73.00 | $51.00 | - + | |
5g | 97% | in stock | $232.00 | $162.00 | - + | |
25g | 97% | in stock | $763.00 | $534.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG76776 |
Chemical Name: | 1-Bromo-2-(bromomethyl)-3-nitrobenzene |
CAS Number: | 58579-54-7 |
Molecular Formula: | C7H5Br2NO2 |
Molecular Weight: | 294.9281 |
MDL Number: | MFCD11036286 |
SMILES: | BrCc1c(Br)cccc1[N+](=O)[O-] |
Complexity: | 171 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
1-Bromo-2-(bromomethyl)-3-nitrobenzene is a versatile chemical compound that finds wide application in chemical synthesis. As a key intermediate in organic chemistry, this compound serves as a valuable building block for creating complex molecules through various reactions. Due to its unique structure, 1-Bromo-2-(bromomethyl)-3-nitrobenzene enables the introduction of both bromine and nitro groups into target molecules, facilitating the synthesis of a range of functionalized compounds. In particular, this compound is commonly used in the pharmaceutical industry for the preparation of drug candidates and in the agrochemical sector for designing novel pesticides. Additionally, its reactivity makes it a crucial component in materials science for producing advanced polymers and specialty chemicals. In the field of medicinal chemistry, 1-Bromo-2-(bromomethyl)-3-nitrobenzene plays a crucial role in the development of new therapeutics by enabling the modification of drug structures to enhance their biological activity. Overall, the application of this compound in chemical synthesis underscores its significance as a fundamental building block for creating diverse and valuable compounds with specific properties and functionalities.