logo
Home  > Chemistry  > Organic Building Blocks  > Azoes  > Azobenzene-4,4'-dicarboxylic acid

AB70805

586-91-4 | Azobenzene-4,4'-dicarboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $12.00 $9.00 -   +
1g 95% in stock $30.00 $21.00 -   +
5g 95% in stock $95.00 $67.00 -   +
25g 95% in stock $350.00 $245.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB70805
Chemical Name: Azobenzene-4,4'-dicarboxylic acid
CAS Number: 586-91-4
Molecular Formula: C14H10N2O4
Molecular Weight: 270.2402
MDL Number: MFCD00496621
SMILES: OC(=O)c1ccc(cc1)/N=N/c1ccc(cc1)C(=O)O

 

Upstream Synthesis Route
  • 4,4'-Azobenzenedicarboxylic acid, also known as azodicarboxylic acid, is a key compound used in chemical synthesis for its unique properties and versatile applications. In organic chemistry, this compound serves as a valuable reagent for the preparation of azo dyes, which are commonly utilized in the textile industry for coloring fabrics with vibrant and long-lasting hues. Additionally, 4,4'-Azobenzenedicarboxylic acid plays a crucial role in the synthesis of polymers and coordination complexes, where its azo functional group serves as a versatile linking unit for forming intricate molecular structures. Furthermore, this compound can be employed in the fabrication of photoresponsive materials, such as light-sensitive polymers and liquid crystal systems, due to its ability to undergo reversible photoisomerization reactions upon exposure to specific wavelengths of light. Its significance in chemical synthesis extends to the development of molecular switches, sensors, and materials with tunable properties, making 4,4'-Azobenzenedicarboxylic acid a valuable building block in the realm of modern chemistry.
FEATURED PRODUCTS